
Catalog Number	AR00E9BD
Chemical Name	Bevantolol
CAS Number	59170-23-9
Molecular Formula	C20H27NO4
Molecular Weight	345.4327
MDL Number	MFCD00864681
SMILES	COc1cc(CCNCC(COc2cccc(c2)C)O)ccc1OC

Bevantolol is a beta-adrenergic blocking agent that finds significant application in chemical synthesis. As a versatile compound, Bevantolol is commonly used as a building block in the creation of more complex organic molecules. Due to its unique structural features, Bevantolol serves as a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its presence in chemical reactions allows for the introduction of specific functional groups and stereochemistry, making it a valuable tool for chemists in the design and production of new compounds. Furthermore, Bevantolol's role in chemical synthesis extends to research and development, where its properties can be harnessed to explore novel synthetic pathways and enhance the efficiency of processes. Through strategic utilization in synthetic routes, Bevantolol contributes to the advancement of drug discovery and the synthesis of key building blocks in organic chemistry.