
Catalog Number	AR00F0MN
Chemical Name	N-methyl-2,6-dinitroaniline
CAS Number	5910-19-0
Molecular Formula	C7H7N3O4
Molecular Weight	197.1482
MDL Number	MFCD00044067
SMILES	CNc1c(cccc1[N+](=O)[O-])[N+](=O)[O-]

As a professional chemist, I can provide detailed insight into the application of N-Methyl-2,6-dinitroaniline in chemical synthesis. N-Methyl-2,6-dinitroaniline, a versatile compound, serves as a critical building block in the creation of various organic compounds. It acts as a key intermediate in the synthesis of complex molecules, particularly in the pharmaceutical and agrochemical industries. With its unique chemical properties, N-Methyl-2,6-dinitroaniline enables the formation of diverse compounds through reactions such as nitration, reduction, and substitution. Its strategic role in chemical synthesis lies in its ability to introduce specific functional groups into target molecules, thereby influencing their properties and applications. By incorporating N-Methyl-2,6-dinitroaniline into synthesis pathways, chemists can tailor the structure and characteristics of final products, enhancing their utility across multiple sectors.