
Catalog Number	AR00EA5M
Chemical Name	HEXYL-BETA-D-GLUCOPYRANOSIDE
CAS Number	59080-45-4
Molecular Formula	C12H24O6
Molecular Weight	264.3154
MDL Number	MFCD00063305
SMILES	CCCCCCO[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Hexyl b-D-glucopyranoside, also known as n-hexyl-β-D-glucopyranoside, is a non-ionic detergent commonly used in chemical synthesis. This compound acts as a mild and effective surfactant, making it ideal for solubilizing membrane proteins and lipids in biological studies. In chemical synthesis, Hexyl b-D-glucopyranoside is often employed as a stabilizer or emulsifier in various reactions due to its amphiphilic nature. Its ability to form micelles also makes it useful in aiding the solubilization of hydrophobic compounds and enhancing the overall reaction efficiency. Additionally, Hexyl b-D-glucopyranoside can function as a carrier molecule for certain hydrophobic reagents, enabling their efficient delivery to desired reaction sites. This versatile compound plays a crucial role in facilitating numerous chemical processes by promoting solubility and aiding in the effective synthesis of complex molecules.