
Catalog Number	AR00EF0T
Chemical Name	4-[(4-CHLOROBENZYL)OXY]BENZALDEHYDE
CAS Number	59067-46-8
Molecular Formula	C14H11ClO2
Molecular Weight	246.6889
MDL Number	MFCD00850629
SMILES	O=Cc1ccc(cc1)OCc1ccc(cc1)Cl

4-(4-Chlorobenzyloxy)benzaldehyde is a versatile compound widely used in chemical synthesis. Its primary application lies in its role as a key building block in the synthesis of various organic molecules. As an aldehyde, it serves as a valuable starting material for the construction of complex structures through a range of organic reactions.One important use of 4-(4-Chlorobenzyloxy)benzaldehyde is in the preparation of pharmaceutical intermediates. Its unique structure allows for the introduction of diverse functional groups, enabling the synthesis of biologically active compounds. Additionally, this compound can be utilized in the creation of specialty chemicals and materials due to its reactivity and compatibility with various synthetic methodologies.Furthermore, 4-(4-Chlorobenzyloxy)benzaldehyde plays a crucial role in the development of advanced materials such as polymers, dyes, and optical brighteners. Its presence in the chemical synthesis process facilitates the production of high-performance materials with tailored properties for specific industrial applications.Overall, the versatility and reactivity of 4-(4-Chlorobenzyloxy)benzaldehyde make it a valuable tool in chemical synthesis, enabling the creation of diverse compounds essential in pharmaceuticals, specialty chemicals, and advanced materials industries.