
Catalog Number	AR00IB6Z
Chemical Name	(3-Methyl-1H-indol-5-yl)boronic acid
CAS Number	590417-54-2
Molecular Formula	C9H10BNO2
Molecular Weight	174.9922
MDL Number	MFCD27987717
SMILES	OB(c1ccc2c(c1)c(C)c[nH]2)O

(3-Methyl-1H-indol-5-yl)boronic acid, also known as $name$, serves as a versatile building block in organic synthesis. This compound is widely utilized in various chemical transformations due to its unique reactivity and selectivity. In chemical synthesis, (3-Methyl-1H-indol-5-yl)boronic acid acts as a valuable precursor for the construction of complex molecules, particularly in the field of pharmaceuticals and agrochemicals.One of the key applications of (3-Methyl-1H-indol-5-yl)boronic acid is its role as a Suzuki-Miyaura coupling partner. This reaction, which involves the cross-coupling of an organoboron compound with an aryl or vinyl halide, is a powerful tool in modern organic chemistry for the formation of carbon-carbon bonds. By utilizing (3-Methyl-1H-indol-5-yl)boronic acid in Suzuki-Miyaura reactions, chemists can access a wide range of substituted indole derivatives that are important in medicinal chemistry and material science.Furthermore, (3-Methyl-1H-indol-5-yl)boronic acid can also participate in other types of boron-mediated transformations, such as Chan-Lam coupling, borylation, and protodeboronation reactions. These reactions allow for the installation of boron functionalities onto organic molecules or facilitate the removal of the boron group in a controlled manner.Overall, the versatility of (3-Methyl-1H-indol-5-yl)boronic acid in chemical synthesis makes it a valuable tool for the efficient and selective construction of complex organic molecules with diverse applications in the pharmaceutical and agrochemical industries.