
Catalog Number	AR00EEQK
Chemical Name	3-[(3-FLUOROBENZYL)OXY]BENZALDEHYDE
CAS Number	590353-54-1
Molecular Formula	C14H11FO2
Molecular Weight	230.2343
MDL Number	MFCD03422452
SMILES	O=Cc1cccc(c1)OCc1cccc(c1)F

3-((3-Fluorobenzyl)oxy)benzaldehyde is a versatile compound widely used in chemical synthesis for its unique properties. One key application of this compound is in the preparation of heterocyclic compounds, specifically in the synthesis of medicinally important molecules such as pharmaceuticals and agrochemicals. The aldehyde functional group in 3-((3-Fluorobenzyl)oxy)benzaldehyde allows for various reactions, including nucleophilic addition reactions, leading to the formation of complex molecular structures. Additionally, the presence of the fluorine atom enhances the reactivity and selectivity of the compound, making it a valuable building block in organic synthesis. Chemists often utilize 3-((3-Fluorobenzyl)oxy)benzaldehyde as a key intermediate in the development of novel compounds with diverse biological activities and pharmacological properties. Its strategic placement within molecular frameworks offers synthetic chemists a powerful tool for designing and creating advanced materials with specific functions tailored for various applications.