
Catalog Number	AR00EB9W
Chemical Name	6-KETO-PROSTAGLANDIN F1ALPHA
CAS Number	58962-34-8
Molecular Formula	C20H34O6
Molecular Weight	370.4804
MDL Number	MFCD00135222
SMILES	CCCCCC(C=CC1C(O)CC(C1CC(=O)CCCCC(=O)O)O)O

6-Keto-PGF1α, a valuable compound derived from prostaglandins, plays a crucial role in chemical synthesis as a versatile building block. This compound is primarily utilized as a precursor in the synthesis of various pharmaceutical agents, such as anti-inflammatory drugs and analgesics. Its unique structure and functional groups make it an ideal intermediate for the formation of more complex molecules through organic transformations. In addition, 6-Keto-PGF1α serves as a key starting material in the development of novel therapeutic compounds targeting specific biological pathways. Its application in chemical synthesis extends to the research and development of new drug candidates with improved efficacy and reduced side effects. By harnessing the reactivity and potential of 6-Keto-PGF1α, chemists can advance the field of medicinal chemistry and pave the way for innovative pharmaceutical solutions.