
Catalog Number	AR00IB5Q
Chemical Name	L-Proline, L-valyl-L-prolyl-
CAS Number	58872-39-2
Molecular Formula	C15H25N3O4
Molecular Weight	311.3767
MDL Number	MFCD08458654
SMILES	CC([C@@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O)N)C

The (S)-1-((S)-1-((S)-2-Amino-3-methylbutanoyl)pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid, a compound known for its chiral properties, plays a crucial role in chemical synthesis as a versatile building block. This compound serves as a key intermediate in the preparation of peptide-based pharmaceuticals and bioactive molecules through solid-phase peptide synthesis. Specifically, its unique structure allows for precise control over the stereochemistry of the synthesized peptides, leading to the production of highly pure and biologically active compounds. Moreover, the (S)-1-((S)-1-((S)-2-Amino-3-methylbutanoyl)pyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid enables chemists to design and create complex peptide structures with tailored properties, making it an essential tool in the field of organic chemistry and drug discovery.