
Catalog Number	AR00EEIG
Chemical Name	3-Methyl-1H-indole-5-carboxylicacid
CAS Number	588688-44-2
Molecular Formula	C10H9NO2
Molecular Weight	175.184
MDL Number	MFCD11052228
SMILES	Cc1c[nH]c2c1cc(cc2)C(=O)O

The 3-Methyl-1H-indole-5-carboxylic acid, also known as $name$, is a crucial building block in chemical synthesis. Its application in organic chemistry is notable for its ability to serve as a key intermediate in the preparation of various pharmaceutical compounds and natural products. Specifically, $name$ can be utilized in the synthesis of bioactive molecules such as indole alkaloids, which have shown significant pharmacological potential in drug discovery research. Furthermore, its unique structural properties make it a valuable precursor for the formation of diverse heterocyclic compounds, playing a pivotal role in the creation of complex molecular structures with potential medicinal applications. This versatile compound's versatility in chemical reactions and its importance as a starting material make it an indispensable tool for organic chemists seeking to develop novel compounds with therapeutic significance.