
Catalog Number	AR01CCHG
Chemical Name	19-Norpregna-4,6-diene-3,20-dione, 17-(acetyloxy)-6-methyl-
CAS Number	58652-20-3
Molecular Formula	C23H30O4
Molecular Weight	370.4819
MDL Number	MFCD00941390
SMILES	CC(=O)O[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2C=C(C2=CC(=O)CC[C@H]12)C)C(=O)C

Nomegestrol acetate is a versatile compound frequently utilized in chemical synthesis due to its remarkable properties. It serves as a crucial building block in the creation of various pharmaceutical products, particularly in the development of hormone-based medications. In chemical synthesis, nomegestrol acetate acts as a precursor in the production of synthetic progestogens, which are vital components in the formulation of contraceptives and hormone replacement therapies. By serving as a key intermediate, nomegestrol acetate plays a significant role in the synthesis of complex organic molecules that are essential in the pharmaceutical industry. Its unique structure and reactivity make it an invaluable tool for chemists and researchers striving to innovate in drug discovery and development.