
Catalog Number	AR019L0A
Chemical Name	2-(2-nitrophenoxy)acetamide
CAS Number	58562-46-2
Molecular Formula	C8H8N2O4
Molecular Weight	196.1601
MDL Number	MFCD07101223
SMILES	NC(=O)COc1ccccc1[N+](=O)[O-]

2-(2-Nitrophenoxy)acetamide, a versatile compound in chemical synthesis, serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Due to its unique structure and reactivity, this compound plays a key role as a precursor in the synthesis of diverse organic molecules with important biological activities. Its ability to undergo various functional group transformations allows for the efficient production of complex molecules with high purity and yield. In addition to its significance in medicinal chemistry, 2-(2-Nitrophenoxy)acetamide finds use in the development of advanced materials and polymers, showcasing its broad applications across different sectors of the chemical industry.