
Catalog Number	AR00ED8J
Chemical Name	4-Phenyl-quinolin-2-ol
CAS Number	5855-57-2
Molecular Formula	C15H11NO
Molecular Weight	221.2539
MDL Number	MFCD01109585
SMILES	O=c1[nH]c2ccccc2c(c1)c1ccccc1

4-Phenylquinolin-2-ol is a versatile compound that finds key applications in chemical synthesis due to its unique structure and reactivity. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and materials. Its functional groups allow for easy modification and derivatization, making it a valuable intermediate in organic synthesis. In particular, 4-Phenylquinolin-2-ol is utilized in the development of novel drug compounds, where its structural characteristics contribute to the desired pharmacological activity. Additionally, its presence in the synthesis of specialty chemicals highlights its importance in creating tailored products for specific industrial applications. In summary, 4-Phenylquinolin-2-ol plays a crucial role in advancing chemical synthesis processes and enabling the production of diverse and innovative compounds.