
Catalog Number	AR00EGIF
Chemical Name	REBAUDIOSIDE B(P)(NEW)
CAS Number	58543-17-2
Molecular Formula	C38H60O18
Molecular Weight	804.8722
MDL Number	MFCD02752303
SMILES	OC[C@H]1O[C@@H](O[C@@]23CC[C@@H]4[C@@](C2)(CC3=C)CC[C@H]2[C@@]4(C)CCC[C@@]2(C)C(=O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Rebaudioside B is a natural sweetening agent derived from the Stevia rebaudiana plant. In chemical synthesis, this compound serves a pivotal role as a starting material or building block for creating various other chemical compounds. Its unique structure and properties make it an ideal candidate for use in the production of pharmaceuticals, agrochemicals, and flavoring agents. Due to its high purity and potency, Rebaudioside B can be utilized in the synthesis of novel drug candidates, food additives, and fragrances. Additionally, its non-toxic nature and lack of calorific value make it a preferred choice for applications in the food and beverage industry.