
Catalog Number	AR00EHDX
Chemical Name	3,4-DIACETOXY-BENZOIC ACID
CAS Number	58534-64-8
Molecular Formula	C11H10O6
Molecular Weight	238.1935
MDL Number	MFCD00017516
SMILES	CC(=O)Oc1cc(ccc1OC(=O)C)C(=O)O

3,4-Diacetoxybenzoic acid, also known as DABA, is a versatile compound widely used in chemical synthesis. It serves as a key building block for the production of various organic molecules due to its unique reactivity and functional groups. In particular, DABA is commonly employed as a precursor in the synthesis of esters, which are essential in the production of pharmaceuticals, fragrances, and flavoring agents. Additionally, the presence of acetoxy groups in DABA allows for the modification of its chemical properties, enabling the creation of novel compounds with tailored functionalities for diverse applications in the field of organic chemistry. Its role in the formation of esters and its ability to undergo various chemical transformations make 3,4-Diacetoxybenzoic acid a valuable reagent in the realm of chemical synthesis.

Pyridine, 3-bromo-2,6-bis(phenylmethoxy)-

16727-47-2

$3.00/250mg, $3.00/100mg, $4.00/1g, $10.00/5g, $16.00/10g, $21.00/25g, $61.00/100g, $122.00/250g, $225.00/500g, $433.00/1kg, $2,077.00/5kg, $3,808.00/10kg,

Product Details