
Catalog Number	AR00EK6Q
Chemical Name	Tert-butyl (S)1-formyl-3-methylbutylcarbamate
CAS Number	58521-45-2
Molecular Formula	C11H21NO3
Molecular Weight	215.2893
MDL Number	MFCD00143835
SMILES	O=C[C@@H](NC(=O)OC(C)(C)C)CC(C)C

The compound Tert-butyl (S)-1-formyl-3-methylbutylcarbamate plays a crucial role in chemical synthesis as a versatile building block. With its unique structure and reactivity, this compound serves as a key intermediate in the construction of complex organic molecules. Its application in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals demonstrates its significance in the field of organic chemistry. By utilizing Tert-butyl (S)-1-formyl-3-methylbutylcarbamate as a strategic starting material, chemists can efficiently access a variety of challenging molecular structures, enabling the development of novel and valuable compounds with diverse functionalities.