
Catalog Number	AR00EEES
Chemical Name	Demethyl-Coclaurine
CAS Number	5843-65-2
Molecular Formula	C16H17NO3
Molecular Weight	271.3111
MDL Number	MFCD01736979
SMILES	Oc1ccc(cc1)CC1NCCc2c1cc(O)c(c2)O

Used in various chemical syntheses, Higenamine, a naturally occurring compound found in certain plant species, serves as a valuable reagent for the creation of novel organic molecules. Its unique chemical properties allow for the efficient formation of complex structures through a range of synthetic methodologies. By acting as a catalyst or reactant in key reactions, Higenamine enables chemists to access diverse molecular frameworks that are important in drug discovery, materials science, and other areas of research. Its versatile capabilities make it a crucial tool for the development of innovative chemical processes and the production of valuable compounds.