
Catalog Number	AR00EMI2
Chemical Name	7-chloro-6-nitroquinoline
CAS Number	58416-31-2
Molecular Formula	C9H5ClN2O2
Molecular Weight	208.6012
MDL Number	MFCD18448459
SMILES	[O-][N+](=O)c1cc2cccnc2cc1Cl
NSC Number	39970

7-Chloro-6-nitroquinoline is a versatile compound widely used in chemical synthesis as a key building block for the preparation of various pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable intermediate in organic synthesis processes.In chemical synthesis, 7-Chloro-6-nitroquinoline acts as a precursor for the synthesis of diverse heterocyclic compounds through various multi-step reactions. Its presence facilitates the introduction of specific functional groups and modifications, allowing chemists to tailor the structure and properties of the final product according to desired specifications.Furthermore, this compound serves as a valuable starting material for the development of potential drug candidates due to its pharmacophoric properties and structural features. By incorporating 7-Chloro-6-nitroquinoline into the molecular framework of new molecules, researchers can explore its biological activity and potential therapeutic applications.Overall, the significance of 7-Chloro-6-nitroquinoline in chemical synthesis lies in its versatility and utility as a key intermediate for the efficient and strategic construction of complex molecules with diverse applications in pharmaceutical and agrochemical industries.