
Catalog Number	AR00EG5T
Chemical Name	1-PHENYL-1H-INDOLE-2-CARBOXYLIC ACID
CAS Number	58386-33-7
Molecular Formula	C15H11NO2
Molecular Weight	237.2533
MDL Number	MFCD00602897
SMILES	OC(=O)c1cc2c(n1c1ccccc1)cccc2

1H-Indole-2-carboxylic acid, 1-phenyl- is a highly versatile organic compound that finds wide application in chemical synthesis. Due to its unique structure and reactivity, it serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and organic materials. In synthetic chemistry, this compound acts as a valuable precursor for the synthesis of biologically active molecules, such as indole-based pharmaceuticals and natural products. Its ability to undergo various transformations, such as functional group manipulations and cyclization reactions, makes it a valuable tool for generating complex molecular structures. Overall, 1H-Indole-2-carboxylic acid, 1-phenyl- plays a crucial role in the synthesis of diverse molecules with important applications in the fields of medicine, agriculture, and materials science.