
Catalog Number	AR01FYMN
Chemical Name	Saikosaponin B3
CAS Number	58316-42-0
Molecular Formula	C43H72O14
Molecular Weight	813.0234
MDL Number	MFCD30725478
SMILES	CO[C@@H]1C=C2[C@@H]3CC(C)(C)CC[C@]3(CO)[C@H](C[C@]2([C@]2([C@H]1[C@@]1(C)CC[C@@H]([C@@]([C@@H]1CC2)(C)CO)O[C@@H]1O[C@H](C)[C@@H]([C@@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)C)C)O

Saikosaponin B3, a natural triterpenoid found in certain plants, is a valuable compound frequently employed in chemical synthesis processes. This versatile molecule plays a crucial role in various organic reactions, serving as a key reagent for the formation of complex structures. In the realm of chemical synthesis, Saikosaponin B3 is particularly valued for its ability to participate in diverse transformations, such as esterification, oxidation, and reduction reactions. Its unique structural features make it a sought-after component in the creation of novel organic compounds with potential applications in pharmaceuticals, agrochemicals, and materials science. Leveraging the reactivity and selectivity of Saikosaponin B3, chemists can efficiently construct intricate molecular frameworks, paving the way for the development of cutting-edge products and technologies.