
Catalog Number	AR00EHBM
Chemical Name	bis(4-(glucopyranosyloxy)benzyl) 2-sec-butylmalate
CAS Number	58139-23-4
Molecular Formula	C34H46O17
Molecular Weight	726.7188
MDL Number	MFCD29059903
SMILES	OC[C@H]1O[C@@H](Oc2ccc(cc2)COC(=O)C[C@@](C(=O)OCc2ccc(cc2)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)(CC(C)C)O)[C@@H]([C@H]([C@@H]1O)O)O

Miltarine, a versatile compound in chemical synthesis, plays a crucial role in various reactions due to its unique properties. This potent reagent is commonly utilized as a catalyst in organic transformations to facilitate key bond formations and modifications. With its ability to selectively activate specific functional groups, Miltarine enables chemists to achieve complex molecular structures efficiently.Furthermore, Miltarine serves as a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to promote challenging reactions while retaining high levels of selectivity makes it an indispensable component in the development of novel compounds. Chemists often rely on Miltarine to accelerate reactions, improve yields, and optimize processes, thereby advancing the field of chemical synthesis.In addition to its catalytic applications, Miltarine can also act as a versatile building block, enabling the construction of intricate molecular architectures. Its compatibility with a wide range of functional groups and reaction conditions makes it an attractive option for designing synthetic pathways with high efficiency and precision.Overall, Miltarine's versatility and reliability make it a valuable asset in the realm of chemical synthesis, empowering chemists to explore new possibilities and push the boundaries of synthetic chemistry.