
Catalog Number	AR00IB0J
Chemical Name	2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3,4-dihydro-,1,1-dioxide
CAS Number	58-93-5
Molecular Formula	C7H8ClN3O4S2
Molecular Weight	297.7391
MDL Number	MFCD06410969
SMILES	Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N

6-Chloro-3,4-Dihydro-(2H)-1,2,4-Benzothiadiazine-7-Sulfonamide 1,1-Dioxide, also known as $name$, is a versatile compound widely used in chemical synthesis processes. Specifically, this compound plays a crucial role as a building block in the creation of novel pharmaceuticals, agrochemicals, and specialty chemicals.Its unique structural properties make it an essential component in the development of various drug candidates, particularly in the field of medicinal chemistry. By utilizing $name$ in chemical synthesis, researchers are able to access a diverse array of molecular structures that exhibit promising biological activities.Moreover, due to its sulfonamide moiety, $name$ serves as a valuable intermediate for the synthesis of sulfonamide derivatives, which have wide-ranging applications in fields such as organic synthesis and material science. The presence of the chloro group further enhances its reactivity and allows for selective functionalization to generate tailored molecules for specific applications.In conclusion, the application of 6-Chloro-3,4-Dihydro-(2H)-1,2,4-Benzothiadiazine-7-Sulfonamide 1,1-Dioxide in chemical synthesis opens up new possibilities for the development of innovative compounds with diverse biological and chemical properties.