
Catalog Number	AR00EBDJ
Chemical Name	3'-METHOXY-BIPHENYL-4-CARBOXYLIC ACID
CAS Number	5783-36-8
Molecular Formula	C14H12O3
Molecular Weight	228.2433
MDL Number	MFCD03424601
SMILES	COc1cccc(c1)c1ccc(cc1)C(=O)O

3'-Methoxy-[1,1'-biphenyl]-4-carboxylic acid, also known as $name$, is a versatile compound widely utilized in chemical synthesis. This compound serves as a crucial building block in the production of various pharmaceuticals, agrochemicals, and advanced materials. In chemical synthesis, $name$ is frequently employed as a key intermediate in the creation of complex organic molecules due to its unique structure and reactivity. Its methoxy and carboxylic acid functional groups enable it to participate in a range of important reactions such as esterification, amidation, and Suzuki-Miyaura cross-coupling, allowing for the derivation of structurally diverse compounds with enhanced properties. As a result, $name$ plays a pivotal role in expanding the scope of organic synthesis and facilitating the development of novel compounds with potential applications in diverse fields.