
Catalog Number	AR00EHO5
Chemical Name	6,7-Dimethyl-4-oxo-4H-chromene-3-carbaldehyde
CAS Number	57803-07-3
Molecular Formula	C12H10O3
Molecular Weight	202.206
MDL Number	MFCD00192181
SMILES	O=Cc1coc2c(c1=O)cc(c(c2)C)C

6,7-Dimethyl-4-oxo-4H-chromene-3-carbaldehyde, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis. With its unique molecular structure, $name$ plays a crucial role in various synthetic pathways for the production of pharmaceuticals, agrochemicals, and specialty organic compounds.In organic synthesis, $name$ serves as a key building block for the construction of complex molecules due to its functional groups and reactivity. It can undergo various transformations such as condensation reactions, nucleophilic additions, and oxidative processes to form structurally diverse products. Additionally, the aldehyde group in $name$ enables it to participate in important carbon-carbon bond forming reactions, making it an indispensable component in the development of novel chemical entities.Moreover, the presence of the chromene ring system in $name$ imparts unique properties to the synthesized compounds, making them potentially valuable in medicinal chemistry and material science. The chromene scaffold is known for its bioactivity and diverse pharmacological properties, making it a valuable motif in drug discovery and development.Overall, the strategic utilization of 6,7-Dimethyl-4-oxo-4H-chromene-3-carbaldehyde in chemical synthesis enables researchers and chemists to access a wide range of functionalized compounds with significant implications in various industries.