
Catalog Number	AR00F0GH
Chemical Name	TA-03
CAS Number	5778-80-3
Molecular Formula	C14H16N2O
Molecular Weight	228.2896400000001
MDL Number	MFCD01237613
SMILES	COc1ccc2c(c1)c(N)c1c(n2)CCCC1

7-Methoxytacrine is a versatile compound that finds application in chemical synthesis as a key intermediate in the production of pharmaceuticals and organic compounds. This particular molecule plays a crucial role in the development of new drugs with potential therapeutic benefits, particularly in the treatment of neurodegenerative diseases such as Alzheimer's. In chemical syntheses, 7-Methoxytacrine serves as a building block for creating more complex structures through various transformations and reactions. Its unique chemical properties enable chemists to modify its structure and functional groups to generate novel molecules with improved pharmacological activities. As a valuable tool in the hands of synthetic chemists, 7-Methoxytacrine opens up a realm of possibilities for creating innovative compounds that could have significant impacts on healthcare and research endeavors.