
Catalog Number	AR00E9TD
Chemical Name	4'-Chloro-4-cyanobiphenyl
CAS Number	57774-36-4
Molecular Formula	C13H8ClN
Molecular Weight	213.6623
MDL Number	MFCD05980153
SMILES	N#Cc1ccc(cc1)c1ccc(cc1)Cl

4'-Chloro-[1,1'-biphenyl]-4-carbonitrile is a versatile chemical compound that finds wide application in chemical synthesis. As a key building block in organic chemistry, this compound serves as an important intermediate in the production of various advanced materials and pharmaceuticals. Its unique structure and reactivity make it a valuable reagent in the synthesis of complex molecules, allowing for diverse modifications and functionalizations. In organic synthesis, 4'-Chloro-[1,1'-biphenyl]-4-carbonitrile is commonly used for introducing specific groups or motifs into target molecules, enabling the creation of novel compounds with tailored properties. With its significance in chemical transformations, this compound plays a crucial role in advancing research and development efforts across different industries.