
Catalog Number	AR01DQZ5
Chemical Name	Luteinizing hormone-releasing factor (swine), 6-D-tryptophan-
CAS Number	57773-63-4
Molecular Formula	C64H82N18O13
Molecular Weight	1311.4487
MDL Number	MFCD00167541
SMILES	OC[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NCC(=O)N)CCCNC(=N)N)CC(C)C)Cc1c[nH]c2c1cccc2)Cc1ccc(cc1)O)NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@@H](NC(=O)[C@@H]1CCC(=O)N1)Cc1[nH]cnc1

6-D-Tryptophan is a crucial amino acid derivative that holds great significance in chemical synthesis applications, particularly in the realm of luteinizing hormone-releasing hormone (LHRH). This specialized compound, known for its unique structure and properties, serves as a key building block in the creation of various peptide-based compounds through solid-phase peptide synthesis (SPPS) techniques. Its incorporation into the peptide chain of LHRH analogs plays a vital role in enhancing the stability, bioactivity, and pharmacokinetic properties of the resulting molecules. By leveraging the specific reactivity and structural features of 6-D-Tryptophan, chemists can efficiently modify and optimize the performance characteristics of LHRH and related peptides for diverse research and therapeutic applications.