
Catalog Number	AR00VVDP
Chemical Name	8-hydroxynaphthalene-2-carboxylic acid
CAS Number	5776-28-3
Molecular Formula	C11H8O3
Molecular Weight	188.1794
MDL Number	MFCD16987424
SMILES	OC(=O)c1ccc2c(c1)c(O)ccc2

2-Naphthalenecarboxylic acid, 8-hydroxy- is a versatile compound widely used in chemical synthesis processes. Due to its unique properties, this compound serves as a crucial building block in the creation of various organic molecules. Its hydroxy group plays a vital role in facilitating reactions that lead to the formation of intricate chemical structures. Whether it is utilized as a starting material for the synthesis of pharmaceuticals, agrochemicals, or materials science applications, 2-Naphthalenecarboxylic acid, 8-hydroxy- proves to be an indispensable component in the realm of organic chemistry. Its ability to participate in diverse chemical transformations makes it a valuable asset for researchers and chemists seeking to develop novel compounds with specific functionalities.