
Catalog Number	AR00EAOX
Chemical Name	2-(4-Methoxyphenyl)-1,3-thiazole-4-carboxylic acid
CAS Number	57677-80-2
Molecular Formula	C11H9NO3S
Molecular Weight	235.2591
MDL Number	MFCD03791177
SMILES	COc1ccc(cc1)c1scc(n1)C(=O)O

2-(4-Methoxyphenyl)thiazole-4-carboxylic acid is a versatile compound used in chemical synthesis as a key building block for the creation of various pharmaceuticals and fine chemicals. Its unique structure, containing both a thiazole and carboxylic acid moiety, makes it valuable in the development of organic molecules with targeted properties.In chemical synthesis, 2-(4-Methoxyphenyl)thiazole-4-carboxylic acid can serve as a starting material for the synthesis of bioactive compounds, such as potential drug candidates or agrochemicals. Its thiazole ring provides aromaticity and electron density, allowing for diverse reactivity in organic reactions, while the carboxylic acid group offers a handle for further functionalization.Additionally, the presence of the methoxyphenyl group in the molecule can impart specific properties to the final products, such as increased solubility or enhanced binding affinity to biological targets. This enables the fine-tuning of the compound's pharmacological or chemical properties for specific applications.Overall, the strategic placement of functional groups in 2-(4-Methoxyphenyl)thiazole-4-carboxylic acid makes it a valuable intermediate in chemical synthesis, facilitating the creation of novel molecules with potential applications in various sectors of the chemical industry.