
Catalog Number	AR00EJTB
Chemical Name	3-(3-(benzyloxy)phenyl)propanoic acid
CAS Number	57668-34-5
Molecular Formula	C16H16O3
Molecular Weight	256.2964
MDL Number	MFCD09258905
SMILES	OC(=O)CCc1cccc(c1)OCc1ccccc1

3-(3-(Benzyloxy)phenyl)propanoic acid is a versatile compound that finds wide application in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure allows for functional group manipulation and modification, making it a valuable intermediate in organic synthesis. In particular, this compound is often used in the preparation of bioactive molecules and drug intermediates due to its ability to introduce specific functionalities and stereochemistry into target molecules. Additionally, 3-(3-(Benzyloxy)phenyl)propanoic acid is employed in the development of advanced materials and in the production of specialized chemicals used in research and industry.