
Catalog Number	AR01BWA0
Chemical Name	3-Chloro-4-phenylbenzaldehyde
CAS Number	57592-44-6
Molecular Formula	C13H9ClO
Molecular Weight	216.663
MDL Number	MFCD30476460
SMILES	O=Cc1ccc(c(c1)Cl)c1ccccc1

3-Chloro-4-phenylbenzaldehyde is a versatile compound commonly employed in chemical synthesis processes. Its primary application lies in its role as a key building block in the creation of various pharmaceuticals and agrochemicals. The presence of both the chloro and phenyl groups in the compound allows for strategic modifications and transformations, making it a valuable intermediate in organic synthesis. Specifically, this compound is often utilized in the production of diverse heterocyclic compounds, which are essential in drug discovery and development. Additionally, 3-Chloro-4-phenylbenzaldehyde can serve as a precursor in the synthesis of advanced materials and functional molecules due to its unique structural properties. Its compatibility with different reaction conditions and its ability to undergo various chemical reactions make it a crucial component in the synthesis of complex organic compounds with desired properties. Furthermore, its versatility and reactivity make it a staple in the toolkit of chemists and researchers engaged in the design and engineering of novel chemical entities.