
Catalog Number	AR00IAY7
Chemical Name	L-Glutamic acid, 1-methyl 5-(phenylmethyl) ester
CAS Number	57584-59-5
Molecular Formula	C13H17NO4
Molecular Weight	251.2784
MDL Number	MFCD27578300
SMILES	COC(=O)[C@H](CCC(=O)OCc1ccccc1)N

(S)-5-Benzyl 1-methyl 2-aminopentanedioate, also known as $name$, is a valuable compound widely used in chemical synthesis due to its unique properties and versatile reactivity. This compound plays a crucial role in several key processes within the realm of organic chemistry. In chemical synthesis, (S)-5-Benzyl 1-methyl 2-aminopentanedioate serves as a chiral building block, allowing chemists to introduce chirality into their target molecules. By utilizing this compound, researchers can access enantiomerically pure products, a critical requirement in pharmaceuticals, agrochemicals, and materials science. Additionally, (S)-5-Benzyl 1-methyl 2-aminopentanedioate acts as a precursor in the preparation of various complex molecules, enabling the efficient synthesis of biologically active compounds and advanced materials. Its structural characteristics make it a versatile starting material for the generation of diverse chemical entities, making it a valuable asset in the toolbox of synthetic chemists seeking to create novel molecules with tailored properties and functions.