
Catalog Number	AR00E9UQ
Chemical Name	Prenalterol
CAS Number	57526-81-5
Molecular Formula	C12H19NO3
Molecular Weight	225.2842
MDL Number	MFCD01707351
SMILES	O[C@H](COc1ccc(cc1)O)CNC(C)C

The (S)-4-(2-Hydroxy-3-(isopropylamino)propoxy)phenol is a versatile compound that finds significant application in chemical synthesis, particularly in the realm of pharmaceuticals and organic chemistry. This compound serves as a valuable building block in the creation of various drug molecules and complex organic structures.Its hydroxyl and amino groups make it an ideal candidate for incorporation into synthetic pathways that necessitate functionality at these specific sites. The isopropyl group further enhances the compound's reactivity and solubility in organic solvents, allowing for efficient manipulation in a laboratory setting.In chemical synthesis, (S)-4-(2-Hydroxy-3-(isopropylamino)propoxy)phenol can act as a key intermediate in the production of novel drug candidates, enabling chemists to introduce specific functional groups and stereochemistry into the final product. Its unique structure and properties make it a valuable tool for designing and developing new therapeutic agents with tailored pharmacological profiles.