
Catalog Number	AR00EE09
Chemical Name	NE-CARBOXYMETHYL-L-LYSINE
CAS Number	5746-04-3
Molecular Formula	C8H16N2O4
Molecular Weight	204.2236
MDL Number	MFCD04114278
SMILES	OC(=O)CNCCCC[C@@H](C(=O)O)N

Nε-(Carboxymethyl)lysine, or CML, is a key compound commonly utilized in chemical synthesis due to its versatile applications. As a derivative of the amino acid lysine, CML plays a significant role in various chemical reactions and processes.In chemical synthesis, Nε-(Carboxymethyl)lysine serves as a crucial building block for the creation of advanced materials and compounds. Its reactive carboxyl group allows for seamless incorporation into molecular structures, enabling the modification and enhancement of a wide range of chemical products.Furthermore, the unique properties of CML make it particularly valuable in the development of pharmaceuticals, biomaterials, and bioconjugates. Its ability to interact with proteins and biomolecules opens up new possibilities for drug delivery systems and bioactive materials.Overall, Nε-(Carboxymethyl)lysine stands out as a versatile and indispensable component in chemical synthesis, offering boundless opportunities for innovation and discovery in the field of chemistry.