
Catalog Number	AR003UPI
Chemical Name	P-Terphenyl-4-carboxylic acid
CAS Number	5731-15-7
Molecular Formula	C19H14O2
Molecular Weight	274.31326
MDL Number	MFCD00419452
SMILES	OC(=O)c1ccc(cc1)c1ccc(cc1)c1ccccc1

p-Terphenyl-4-carboxylic acid is a versatile compound widely used in chemical synthesis due to its unique structural properties. This compound is essential in the production of fluorescent dyes, organic semiconductors, and pharmaceutical intermediates. In chemical synthesis, p-Terphenyl-4-carboxylic acid serves as a key building block for the creation of complex molecular structures. Its aromatic nature and rigid backbone make it highly suitable for constructing molecules with specific electronic and optical properties. By introducing p-Terphenyl-4-carboxylic acid into reactions, chemists can tailor the properties of the resulting compounds for various applications in materials science, organic electronics, and drug discovery.