
Catalog Number	AR00ERMP
Chemical Name	2-Butanone, 4-[4-(trifluoroMethyl)phenyl]-
CAS Number	57132-19-1
Molecular Formula	C11H11F3O
Molecular Weight	216.1996
MDL Number	MFCD00156405
SMILES	CC(=O)CCc1ccc(cc1)C(F)(F)F

4-[4-(Trifluoromethyl)phenyl]butan-2-one is a versatile compound commonly utilized in chemical synthesis for various applications. As a key building block in organic chemistry, this compound serves as a crucial intermediate in the synthesis of a wide range of pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity make it ideal for incorporating the trifluoromethyl functional group into more complex molecules, enhancing their chemical and biological properties. In addition, 4-[4-(Trifluoromethyl)phenyl]butan-2-one is often employed in the production of specialty polymers, flavors, and fragrances, showcasing its significance in modern industrial processes. Its utility in both academia and industry underscores its importance as a valuable tool for chemical synthesis and discovery.