
Catalog Number	AR00IAUZ
Chemical Name	2-Pyridinecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-
CAS Number	569687-82-7
Molecular Formula	C11H14N2O4
Molecular Weight	238.2399
MDL Number	MFCD02181061
SMILES	O=C(Nc1cccnc1C(=O)O)OC(C)(C)C

The 3-((tert-Butoxycarbonyl)amino)picolinic acid is a highly versatile compound widely used in chemical synthesis. Due to its unique chemical properties, it plays a crucial role in various synthetic processes across the pharmaceutical, agrochemical, and materials science industries.1. Peptide Synthesis: As a key building block in peptide synthesis, 3-((tert-Butoxycarbonyl)amino)picolinic acid serves as a protective group for the amino functionality. It enables selective deprotection and facilitates the formation of peptide bonds, essential for the creation of complex peptide structures.2. Coordination Chemistry: In coordination chemistry, this compound acts as a chelating ligand due to its picolinic acid moiety. This allows for the formation of stable metal complexes, which find applications in catalysis, coordination polymer synthesis, and material design.3. Drug Development: With its potential as a versatile intermediate, 3-((tert-Butoxycarbonyl)amino)picolinic acid contributes significantly to drug development processes. It can be utilized in the synthesis of pharmaceutical compounds, including key intermediates for active pharmaceutical ingredients (APIs).Overall, the 3-((tert-Butoxycarbonyl)amino)picolinic acid plays a pivotal role in chemical synthesis by offering a range of functionalities that enable the efficient construction of diverse molecular architectures.