
Catalog Number	AR00EGGS
Chemical Name	3-(4-NITROPHENYL)PROPYLAMINE HYDROCHLORIDE
CAS Number	56946-60-2
Molecular Formula	C9H13ClN2O2
Molecular Weight	216.6647
MDL Number	MFCD08457983
SMILES	NCCCc1ccc(cc1)[N+](=O)[O-].Cl

3-(4-Nitrophenyl)propylamine hydrochloride is a versatile compound that finds significant application in chemical synthesis processes. This compound acts as a key intermediate in the production of various fine chemicals and pharmaceuticals. Its unique structure allows for the introduction of the 4-nitrophenyl group, which imparts distinct properties to the final products.In chemical synthesis, 3-(4-Nitrophenyl)propylamine hydrochloride serves as a valuable building block for the creation of complex organic molecules. Due to its reactive nature, this compound can undergo various chemical reactions such as nucleophilic substitutions, condensations, and reductions. These reactions enable the modification of its structure to synthesize a wide range of compounds with tailored properties.One common application of 3-(4-Nitrophenyl)propylamine hydrochloride is in the synthesis of pharmaceutical compounds, particularly in the production of drugs with biological activity. By incorporating this compound into the chemical synthesis process, researchers can access novel drug candidates with potential therapeutic benefits. Its role in drug discovery and development highlights the crucial importance of this compound in the pharmaceutical industry.