
Catalog Number	AR00EJSX
Chemical Name	4,8-Dichloroquinoline-3-carboxylic acid ethyl ester
CAS Number	56824-91-0
Molecular Formula	C12H9Cl2NO2
Molecular Weight	270.1114
MDL Number	MFCD00173351
SMILES	CCOC(=O)c1cnc2c(c1Cl)cccc2Cl

Ethyl 4,8-dichloroquinoline-3-carboxylate is a versatile compound commonly used in chemical synthesis for producing a wide range of pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable intermediate in organic synthesis, particularly in the formation of heterocyclic compounds. By incorporating Ethyl 4,8-dichloroquinoline-3-carboxylate into synthetic routes, chemists can efficiently generate complex molecular structures with diverse biological activities. This compound serves as a key building block for creating novel drug candidates, herbicides, and insecticides through various synthetic transformations and functional group manipulations. Its application in chemical synthesis offers researchers a powerful tool for developing innovative solutions in the pharmaceutical and agricultural industries, driving advancements in medicinal chemistry and crop protection technologies.