
Catalog Number	AR00IATI
Chemical Name	Phosphoric acid, 4-hydroxyphenyl diphenyl ester
CAS Number	56806-74-7
Molecular Formula	C18H15O5P
Molecular Weight	342.282461
MDL Number	MFCD30529787
SMILES	Oc1ccc(cc1)OP(=O)(Oc1ccccc1)Oc1ccccc1

4-Hydroxyphenyl diphenyl phosphate, also known as DPHP, is a versatile compound commonly used in chemical synthesis. In the realm of synthetic chemistry, DPHP serves as a key building block for the formation of various organic molecules. Its unique structure and reactivity make it a valuable reagent in the synthesis of polymers, plastics, and other organic materials. By participating in esterification and phosphorylation reactions, 4-Hydroxyphenyl diphenyl phosphate facilitates the creation of new chemical structures with distinct properties and functionalities. Its presence in chemical synthesis processes contributes to the development of innovative materials and compounds across a range of industries.