
Catalog Number	AR00IAT6
Chemical Name	1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-, methyl ester
CAS Number	56720-83-3
Molecular Formula	C10H7NO4
Molecular Weight	205.1669
MDL Number	MFCD00455850
SMILES	COC(=O)c1ccc2c(c1)C(=O)NC2=O

1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-, methyl ester is a versatile compound widely utilized in chemical synthesis for its ability to act as a key building block in the creation of various organic molecules. This compound serves as a crucial intermediate in the production of pharmaceuticals, agrochemicals, and advanced materials due to its unique chemical structure and reactivity.In chemical synthesis, this methyl ester derivative plays a crucial role in the formation of complex organic compounds through various reactions such as esterification, condensation, and reduction. Its structural features enable it to participate in diverse transformations, allowing for the efficient construction of molecular frameworks with specific functionalities.Furthermore, the presence of functional groups in 1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-, methyl ester facilitates derivatization, thereby enabling the introduction of tailored chemical moieties to generate novel compounds with desired properties. Its reactivity and compatibility with a wide range of synthetic methodologies make it an indispensable tool in the hands of organic chemists for the synthesis of diverse chemical entities with potential applications across various industries.

tert-Butyl 4-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylene)piperidine-1-carboxylate

1425970-61-1

$5.00/100mg, $9.00/250mg, $14.00/500mg, $26.00/1g, $70.00/5g, $113.00/10g, $225.00/25g, $433.00/50g, $866.00/100g,

Product Details

4,6-Dichloro-1H-pyrazolo[3,4-d]pyrimidine

42754-96-1

$4.00/250mg, $8.00/1g, $31.00/5g, $61.00/10g, $89.00/15g, $137.00/25g, $261.00/50g, $488.00/100g, $890.00/250g, $1,758.00/500g, $3,327.00/1kg,

Product Details

Ethyl 3-bromo-1H-pyrazole-4-carboxylate

1353100-91-0

$3.00/100mg, $4.00/250mg, $12.00/1g, $33.00/5g, $44.00/10g, $96.00/25g, $347.00/100g, $779.00/250g, $1,385.00/500g,

Product Details

1H-Pyrazole-1,4-dicarboxylic acid, 2,3-dihydro-3-oxo-, 1-(1,1-dimethylethyl) 4-ethyl ester

178424-17-4

$5.00/5g, $8.00/10g, $14.00/25g, $49.00/100g,

Product Details

3-(4-BROMO-2-FLUOROBENZOYL)THIOPHENE

898771-38-5

$500.00/250mg, $800.00/1g,

Product Details