
Catalog Number	AR00ECBG
Chemical Name	1,3,5[10]-ESTRATRIENE-3,16ALPHA-DIOL-17-ONE
CAS Number	566-76-7
Molecular Formula	C18H22O3
Molecular Weight	286.3655
MDL Number	MFCD00870436
SMILES	Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1C[C@H](C2=O)O)C

The compound (8R,9S,13S,14S,16R)-3,16-dihydroxy-13-methyl-7,8,9,11,12,13,15,16-octahydro-6H-cyclopenta[a]phenanthren-17(14H)-one, often referred to as $name$, plays a crucial role in chemical synthesis as a chiral building block. Its unique stereochemistry and functional groups make it a valuable intermediate in the synthesis of complex organic molecules, particularly in the development of pharmaceuticals and natural product derivatives. By strategically incorporating $name$ into synthetic pathways, chemists can effectively control the stereochemistry and introduce specific functionalities required for target molecule production. This compound serves as a versatile starting material in asymmetric catalysis, organocatalysis, and other synthetic methodologies, enabling the construction of diverse molecular frameworks with high efficiency and selectivity.