
Catalog Number	AR00EFIV
Chemical Name	5-CHOLESTEN-3-BETA, 7-ALPHA-DIOL
CAS Number	566-26-7
Molecular Formula	C27H46O2
Molecular Weight	402.65293999999994
MDL Number	MFCD00201416
SMILES	CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2[C@H](O)C=C2[C@]1(C)CC[C@@H](C2)O)C)C

5-CHOLESTEN-3-BETA, 7-ALPHA-DIOL, also known as 5-cholestane-3β,7α-diol, is a steroidal compound that finds wide application in chemical synthesis, particularly in the field of organic chemistry. This versatile molecule serves as a crucial intermediate in the synthesis of various bioactive steroids and hormones.In chemical synthesis, 5-cholesten-3β,7α-diol acts as a key building block for the production of important steroidal compounds. It plays a vital role in the construction of complex steroid molecules due to its specific functional groups and structural properties. Through various chemical transformations and reactions, this compound can be manipulated to introduce specific functionalities at different positions on the steroid backbone.Researchers and chemists utilize 5-cholesten-3β,7α-diol as a precursor to synthesize a wide range of steroid derivatives with diverse pharmacological activities. By modifying the side chains or functional groups attached to the core structure of this compound, novel steroid analogs can be created for potential applications in pharmaceutical research, drug development, and hormone replacement therapy.Overall, the strategic incorporation of 5-cholesten-3β,7α-diol in chemical synthesis enables scientists to access structurally diverse steroid molecules with tailored properties, paving the way for advancements in the fields of medicinal chemistry, biochemistry, and hormone science.