
Catalog Number	AR0039BT
Chemical Name	N-(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)glycyl-L-proline
CAS Number	565453-40-9
Molecular Formula	C17H26N2O4
Molecular Weight	322.3993
MDL Number	MFCD22372063
SMILES	OC(=O)[C@@H]1CCCN1C(=O)CNC12CC3CC(C1)CC(C2)(C3)O

N-(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)glycyl-L-proline is a versatile compound widely utilized in chemical synthesis for its unique structural properties and reactivity. In organic chemistry, this molecule serves as a valuable building block in the construction of complex molecules due to its functional groups and conformational flexibility. Its cyclic tricyclic decalin core provides a rigid framework for stereochemical control, making it an ideal substrate for asymmetric synthesis and drug development. Additionally, the presence of the glycine and proline residues offers opportunities for peptide bond formation and molecular recognition studies. This compound's application in chemical synthesis extends to the production of pharmaceuticals, natural product synthesis, and material science, highlighting its importance in the advancement of synthetic organic chemistry.