
Catalog Number	AR01CCZ2
Chemical Name	2,4-Pyrimidinediamine, 5-[(4-bromo-3,5-dimethoxyphenyl)methyl]-
CAS Number	56518-41-3
Molecular Formula	C13H15BrN4O2
Molecular Weight	339.1878
MDL Number	MFCD00864849
SMILES	COc1cc(Cc2cnc(nc2N)N)cc(c1Br)OC

Brodimoprim, a derivative of the antibacterial agent trimethoprim, serves as a versatile building block in chemical synthesis. This compound finds widespread application as a key intermediate in the synthesis of various pharmaceutical compounds and agrochemicals. In organic synthesis, Brodimoprim is utilized for the construction of complex molecular structures due to its unique reactivity and functional groups. Its presence in the synthesis process enables the efficient formation of new chemical entities with diverse biological activities. Beyond its role as a building block, Brodimoprim also acts as a valuable tool for medicinal chemists in the design and development of novel therapeutic agents. By incorporating Brodimoprim into synthetic pathways, chemists can access a wide array of molecular scaffolds with potential pharmaceutical applications. Additionally, the chemical properties of Brodimoprim make it a valuable component in the creation of custom-designed molecules for drug discovery and development purposes.