
Catalog Number	AR01GIQU
Chemical Name	Butanamide, 2-amino-N,N-diethyl-3-methyl-, (2S)-
CAS Number	56414-87-0
Molecular Formula	C9H20N2O
Molecular Weight	172.2679
MDL Number	MFCD09724687
SMILES	CCN(C(=O)[C@H](C(C)C)N)CC

(S)-2-Amino-N,N-diethyl-3-methylbutanamide is a versatile compound widely used in chemical synthesis, particularly in the pharmaceutical industry. Its unique structure and properties make it an essential building block for the creation of various complex organic molecules. This compound is commonly employed as a chiral auxiliary in asymmetric synthesis, where it serves as a valuable tool for controlling the stereochemistry of reactions.In addition, (S)-2-Amino-N,N-diethyl-3-methylbutanamide can be utilized in the synthesis of biologically active compounds, such as pharmaceutical drugs and agrochemicals. Its presence in the molecular structure imparts specific stereochemical properties, which are crucial for achieving the desired biological activity of the final product. Furthermore, this compound can act as a ligand in coordination chemistry, interacting with metal ions to form stable complexes that exhibit unique reactivity and catalytic properties.Overall, the application of (S)-2-Amino-N,N-diethyl-3-methylbutanamide in chemical synthesis is instrumental in expanding the toolkit available to chemists for creating complex molecules with precise stereochemical control. Its versatile nature and ability to influence reaction outcomes make it a valuable component in the development of novel chemical entities with potential therapeutic or industrial significance.