
Catalog Number	AR00DM8V
Chemical Name	1,3,5-TRIS-TRIMETHYLSILANYL-BENZENE
CAS Number	5624-60-2
Molecular Formula	C15H30Si3
Molecular Weight	294.6552
MDL Number	MFCD00093247
SMILES	C[Si](c1cc(cc(c1)[Si](C)(C)C)[Si](C)(C)C)(C)C

1,3,5-Tris(trimethylsilyl)benzene is a versatile compound widely used in chemical synthesis as a building block for various organic reactions. It serves as a valuable precursor in the synthesis of complex molecules due to its unique chemical properties and reactivity. This compound is commonly used in the formation of functionalized benzenes and substituted aromatic compounds through various transformations, such as cross-coupling reactions, Friedel-Crafts reactions, and metal-catalyzed processes. In addition, 1,3,5-Tris(trimethylsilyl)benzene is utilized in the preparation of oligomers and polymers with tailored properties for applications in materials science and drug discovery. Its high yield and efficiency make it an essential tool in the toolkit of synthetic chemists for the construction of diverse molecular structures with precision and control.