
Catalog Number	AR00DAHW
Chemical Name	Platinate(2-), tetrakis(cyano-kC)-, dipotassium, (SP-4-1)-
CAS Number	562-76-5
Molecular Formula	C4K2N4Pt
Molecular Weight	377.3442
MDL Number	MFCD00149920
SMILES	N#C[Pt-2](C#N)(C#N)C#N.[K+].[K+]

Potassium tetracyanoplatinate(II) is a versatile compound commonly used in chemical synthesis as a catalyst for various reactions. Its unique structure allows it to efficiently facilitate the formation of carbon-carbon bonds through a process known as cross-coupling reactions. This compound is particularly valuable in the production of pharmaceuticals, agrochemicals, and advanced materials due to its high reactivity and selectivity. Additionally, Potassium tetracyanoplatinate(II) plays a crucial role in the preparation of complex organic molecules with intricate structures, making it a go-to catalyst for organic chemists seeking to streamline their synthesis processes. Its broad applicability and effectiveness make it an indispensable tool in modern chemical research and development.