
Catalog Number	AR00E1W4
Chemical Name	N-[(Phenylmethoxy)carbonyl]tyrosine
CAS Number	5618-98-4
Molecular Formula	C17H17NO5
Molecular Weight	315.32057999999995
MDL Number	MFCD00394199
SMILES	O=C(NC(C(=O)O)Cc1ccc(cc1)O)OCc1ccccc1

N-[(Phenylmethoxy)carbonyl]tyrosine, also known as Fmoc-tyrosine, is a vital building block in chemical synthesis methodologies, particularly in the field of peptide synthesis. This compound serves as a key component in solid-phase peptide synthesis (SPPS) due to its ability to protect the tyrosine amino acid residue during chain elongation.In chemical synthesis, Fmoc-tyrosine is utilized as a protected form of tyrosine, safeguarding the amino group of tyrosine from undesired reactions during peptide assembly. By selectively deprotecting the Fmoc group under mild conditions, the tyrosine residue is efficiently incorporated into the growing peptide chain without altering the sequence or structure of the peptide.Furthermore, the distinct properties of Fmoc-tyrosine, such as its compatibility with commonly used coupling reagents and solvents, make it a preferred choice for peptide chemists aiming to synthesize complex peptide sequences with high purity and yield. This compound's versatility and reliability in chemical synthesis play a crucial role in the development of bioactive peptides, pharmaceuticals, and biomolecules with tailored functionalities and properties.