
Catalog Number	AR00DBKC
Chemical Name	N-(3-aminopropyl)-4-methylbenzenesulfonamide
CAS Number	56125-49-6
Molecular Formula	C10H16N2O2S
Molecular Weight	228.3112
MDL Number	MFCD03634548
SMILES	NCCCNS(=O)(=O)c1ccc(cc1)C

N-(3-Aminopropyl)-4-methylbenzenesulfonamide, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. In organic chemistry, $name$ is commonly used as a coupling reagent to facilitate amide bond formation in the synthesis of peptides and other bioactive compounds. Its primary amine functional group enables it to react efficiently with carboxylic acids, leading to the formation of stable amide bonds.Moreover, $name$ can also serve as a key intermediate in the preparation of various sulfonamide derivatives with diverse functional groups. This compound's unique structure imparts specific properties that make it valuable in medicinal chemistry for the development of novel pharmaceuticals. Its sulfonamide moiety offers potential for interactions with biological targets, while the alkyl amine chain provides flexibility in molecular design and modification, allowing for the fine-tuning of pharmacological properties.In summary, the application of N-(3-Aminopropyl)-4-methylbenzenesulfonamide in chemical synthesis extends to the efficient construction of amide bonds for peptide synthesis and the preparation of diverse sulfonamide derivatives with promising pharmacological activities.