
Catalog Number	AR00DBFE
Chemical Name	(R)-2-((3S,5R,10S,13R,14R,17R)-3-Hydroxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methyl-5-methyleneheptanoic acid
CAS Number	560-66-7
Molecular Formula	C31H50O3
Molecular Weight	470.7269
MDL Number	MFCD00238594
SMILES	CC(C(=C)CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C(=O)O)C

The application of (3β)-3-Hydroxy-24-methylenelanost-8-en-21-oic acid in chemical synthesis lies in its role as a valuable starting material for the production of various important organic compounds. This compound serves as a key intermediate in the synthesis of bioactive molecules, pharmaceuticals, and natural products. Through strategic chemical transformations, (3β)-3-Hydroxy-24-methylenelanost-8-en-21-oic acid can be utilized to generate structurally diverse derivatives with enhanced biological activities. Its functional groups and stereochemistry make it a versatile building block for the creation of novel compounds with potential applications in medicinal chemistry and drug development.